C16H19F2N3O — CID 155871319
8-[(3,4-difluorophenyl)methyl]-1-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine (PubChem CID 155871319) has the molecular formula C16H19F2N3O and a molecular weight of 307.34 g/mol. Its IUPAC name is 8-[(3,4-difluorophenyl)methyl]-1-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine.
| Compound Name | 8-[(3,4-difluorophenyl)methyl]-1-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine |
|---|---|
| PubChem CID | 155871319 |
| Molecular Formula | C16H19F2N3O |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 8-[(3,4-difluorophenyl)methyl]-1-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine |
| SMILES | COCc1ncn2c1CN(Cc1ccc(F)c(F)c1)CCC2 |
| InChI | InChI=1S/C16H19F2N3O/c1-22-10-15-16-9-20(5-2-6-21(16)11-19-15)8-12-3-4-13(17)14(18)7-12/h3-4,7,11H,2,5-6,8-10H2,1H3 |
| InChIKey | DUYYKJUVVVPURW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |