C21H28N6O5 — CID 155876825
formic acid;8-[(3-methoxyphenyl)methyl]-1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine (PubChem CID 155876825) has the molecular formula C21H28N6O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is formic acid;8-[(3-methoxyphenyl)methyl]-1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine.
| Compound Name | formic acid;8-[(3-methoxyphenyl)methyl]-1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine |
|---|---|
| PubChem CID | 155876825 |
| Molecular Formula | C21H28N6O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | formic acid;8-[(3-methoxyphenyl)methyl]-1-[(5-methyltriazol-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine |
| SMILES | COc1cccc(CN2CCCn3cnc(Cn4nncc4C)c3C2)c1.O=CO.O=CO |
| InChI | InChI=1S/C19H24N6O.2CH2O2/c1-15-10-21-22-25(15)12-18-19-13-23(7-4-8-24(19)14-20-18)11-16-5-3-6-17(9-16)26-2;2*2-1-3/h3,5-6,9-10,14H,4,7-8,11-13H2,1-2H3;2*1H,(H,2,3) |
| InChIKey | SKEKPMICMRIRPV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|