C20H26F3N3O5 — CID 155853518
2-[[8-[(4-methoxyphenyl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanol;2,2,2-trifluoroacetic acid (PubChem CID 155853518) has the molecular formula C20H26F3N3O5 and a molecular weight of 445.44 g/mol. Its IUPAC name is 2-[[8-[(4-methoxyphenyl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanol;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[8-[(4-methoxyphenyl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155853518 |
| Molecular Formula | C20H26F3N3O5 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 2-[[8-[(4-methoxyphenyl)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanol;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CN2CCCn3cnc(COCCO)c3C2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25N3O3.C2HF3O2/c1-23-16-5-3-15(4-6-16)11-20-7-2-8-21-14-19-17(18(21)12-20)13-24-10-9-22;3-2(4,5)1(6)7/h3-6,14,22H,2,7-13H2,1H3;(H,6,7) |
| InChIKey | WREUPSSSLBAOSU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|