C14H24F3N5O5S — CID 155830469
N,N-dimethyl-2-[(5-methylsulfonyl-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl)methoxy]ethanamine;2,2,2-trifluoroacetic acid (PubChem CID 155830469) has the molecular formula C14H24F3N5O5S and a molecular weight of 431.44 g/mol. Its IUPAC name is N,N-dimethyl-2-[(5-methylsulfonyl-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl)methoxy]ethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-2-[(5-methylsulfonyl-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl)methoxy]ethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155830469 |
| Molecular Formula | C14H24F3N5O5S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N,N-dimethyl-2-[(5-methylsulfonyl-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl)methoxy]ethanamine;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCOCc1nnn2c1CN(S(C)(=O)=O)CCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H23N5O3S.C2HF3O2/c1-15(2)7-8-20-10-11-12-9-16(21(3,18)19)5-4-6-17(12)14-13-11;3-2(4,5)1(6)7/h4-10H2,1-3H3;(H,6,7) |
| InChIKey | VQWAKYXXKJVOMY-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|