C17H24F3N7O3 — CID 155841806
N,N-dimethyl-2-[[7-(6-methylpyridazin-3-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]methoxy]ethanamine;2,2,2-trifluoroacetic acid (PubChem CID 155841806) has the molecular formula C17H24F3N7O3 and a molecular weight of 431.42 g/mol. Its IUPAC name is N,N-dimethyl-2-[[7-(6-methylpyridazin-3-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]methoxy]ethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-2-[[7-(6-methylpyridazin-3-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]methoxy]ethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155841806 |
| Molecular Formula | C17H24F3N7O3 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N,N-dimethyl-2-[[7-(6-methylpyridazin-3-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]methoxy]ethanamine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(N2CCn3c(COCCN(C)C)nnc3C2)nn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N7O.C2HF3O2/c1-12-4-5-13(17-16-12)21-6-7-22-14(10-21)18-19-15(22)11-23-9-8-20(2)3;3-2(4,5)1(6)7/h4-5H,6-11H2,1-3H3;(H,6,7) |
| InChIKey | ASZSIRWZBKJKME-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|