C16H25N5OS — CID 97381522
N,N-dimethyl-2-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]ethanamine (PubChem CID 97381522) has the molecular formula C16H25N5OS and a molecular weight of 335.48 g/mol. Its IUPAC name is N,N-dimethyl-2-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]ethanamine |
|---|---|
| PubChem CID | 97381522 |
| Molecular Formula | C16H25N5OS |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N,N-dimethyl-2-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]ethanamine |
| SMILES | CN(C)CCOCc1nnc2n1CCN(Cc1ccsc1)CC2 |
| InChI | InChI=1S/C16H25N5OS/c1-19(2)8-9-22-12-16-18-17-15-3-5-20(6-7-21(15)16)11-14-4-10-23-13-14/h4,10,13H,3,5-9,11-12H2,1-2H3 |
| InChIKey | ZHDFBSMYGKMQJE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|