C25H33N5OS — CID 42275168
3,5-dimethyl-N-[(1S)-3-methyl-1-[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]benzamide (PubChem CID 42275168) has the molecular formula C25H33N5OS and a molecular weight of 451.64 g/mol. Its IUPAC name is 3,5-dimethyl-N-[(1S)-3-methyl-1-[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]benzamide.
| Compound Name | 3,5-dimethyl-N-[(1S)-3-methyl-1-[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]benzamide |
|---|---|
| PubChem CID | 42275168 |
| Molecular Formula | C25H33N5OS |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 3,5-dimethyl-N-[(1S)-3-methyl-1-[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)N[C@@H](CC(C)C)c2nnc3n2CCN(Cc2ccsc2)CC3)c1 |
| InChI | InChI=1S/C25H33N5OS/c1-17(2)11-22(26-25(31)21-13-18(3)12-19(4)14-21)24-28-27-23-5-7-29(8-9-30(23)24)15-20-6-10-32-16-20/h6,10,12-14,16-17,22H,5,7-9,11,15H2,1-4H3,(H,26,31)/t22-/m0/s1 |
| InChIKey | PEPWKEQWILDPTJ-QFIPXVFZSA-N |
| XLogP | 4.53 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |