C26H35N5O5 — CID 42345312
N-[(1R)-3-methyl-1-[7-[(3,4,5-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]furan-2-carboxamide (PubChem CID 42345312) has the molecular formula C26H35N5O5 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-[(1R)-3-methyl-1-[7-[(3,4,5-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]furan-2-carboxamide.
| Compound Name | N-[(1R)-3-methyl-1-[7-[(3,4,5-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42345312 |
| Molecular Formula | C26H35N5O5 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | N-[(1R)-3-methyl-1-[7-[(3,4,5-trimethoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]furan-2-carboxamide |
| SMILES | COc1cc(CN2CCc3nnc([C@@H](CC(C)C)NC(=O)c4ccco4)n3CC2)cc(OC)c1OC |
| InChI | InChI=1S/C26H35N5O5/c1-17(2)13-19(27-26(32)20-7-6-12-36-20)25-29-28-23-8-9-30(10-11-31(23)25)16-18-14-21(33-3)24(35-5)22(15-18)34-4/h6-7,12,14-15,17,19H,8-11,13,16H2,1-5H3,(H,27,32)/t19-/m1/s1 |
| InChIKey | ZXQSNBUHDOYFPT-LJQANCHMSA-N |
| XLogP | 3.47 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |