C23H27F2N5O2 — CID 29149660
N-[(1R)-1-[7-[(2,4-difluorophenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-3-methylbutyl]furan-2-carboxamide (PubChem CID 29149660) has the molecular formula C23H27F2N5O2 and a molecular weight of 443.50 g/mol. Its IUPAC name is N-[(1R)-1-[7-[(2,4-difluorophenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-3-methylbutyl]furan-2-carboxamide.
| Compound Name | N-[(1R)-1-[7-[(2,4-difluorophenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-3-methylbutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 29149660 |
| Molecular Formula | C23H27F2N5O2 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | N-[(1R)-1-[7-[(2,4-difluorophenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-3-methylbutyl]furan-2-carboxamide |
| SMILES | CC(C)C[C@@H](NC(=O)c1ccco1)c1nnc2n1CCN(Cc1ccc(F)cc1F)CC2 |
| InChI | InChI=1S/C23H27F2N5O2/c1-15(2)12-19(26-23(31)20-4-3-11-32-20)22-28-27-21-7-8-29(9-10-30(21)22)14-16-5-6-17(24)13-18(16)25/h3-6,11,13,15,19H,7-10,12,14H2,1-2H3,(H,26,31)/t19-/m1/s1 |
| InChIKey | KGTPHYMIAPHWCQ-LJQANCHMSA-N |
| XLogP | 3.72 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |