C26H33N5O2 — CID 42372971
N-[(1R)-3-methyl-1-[7-[(E)-2-methyl-3-phenylprop-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]furan-2-carboxamide (PubChem CID 42372971) has the molecular formula C26H33N5O2 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-[(1R)-3-methyl-1-[7-[(E)-2-methyl-3-phenylprop-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]furan-2-carboxamide.
| Compound Name | N-[(1R)-3-methyl-1-[7-[(E)-2-methyl-3-phenylprop-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42372971 |
| Molecular Formula | C26H33N5O2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | N-[(1R)-3-methyl-1-[7-[(E)-2-methyl-3-phenylprop-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]furan-2-carboxamide |
| SMILES | C/C(=C\c1ccccc1)CN1CCc2nnc([C@@H](CC(C)C)NC(=O)c3ccco3)n2CC1 |
| InChI | InChI=1S/C26H33N5O2/c1-19(2)16-22(27-26(32)23-10-7-15-33-23)25-29-28-24-11-12-30(13-14-31(24)25)18-20(3)17-21-8-5-4-6-9-21/h4-10,15,17,19,22H,11-14,16,18H2,1-3H3,(H,27,32)/b20-17+/t22-/m1/s1 |
| InChIKey | OXKAHCNZPABTOH-YMQJMOIJSA-N |
| XLogP | 4.35 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |