C26H34N6O3 — CID 45222076
N-[1-[7-[[4-(2-hydroxyethoxy)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-3-methylbutyl]pyridine-3-carboxamide (PubChem CID 45222076) has the molecular formula C26H34N6O3 and a molecular weight of 478.60 g/mol. Its IUPAC name is N-[1-[7-[[4-(2-hydroxyethoxy)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-3-methylbutyl]pyridine-3-carboxamide.
| Compound Name | N-[1-[7-[[4-(2-hydroxyethoxy)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-3-methylbutyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 45222076 |
| Molecular Formula | C26H34N6O3 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | N-[1-[7-[[4-(2-hydroxyethoxy)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]-3-methylbutyl]pyridine-3-carboxamide |
| SMILES | CC(C)CC(NC(=O)c1cccnc1)c1nnc2n1CCN(Cc1ccc(OCCO)cc1)CC2 |
| InChI | InChI=1S/C26H34N6O3/c1-19(2)16-23(28-26(34)21-4-3-10-27-17-21)25-30-29-24-9-11-31(12-13-32(24)25)18-20-5-7-22(8-6-20)35-15-14-33/h3-8,10,17,19,23,33H,9,11-16,18H2,1-2H3,(H,28,34) |
| InChIKey | SERYQPIQMDSYGR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |