C22H28N6OS — CID 42498918
N-[(1S)-3-methyl-1-[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]pyridine-3-carboxamide (PubChem CID 42498918) has the molecular formula C22H28N6OS and a molecular weight of 424.57 g/mol. Its IUPAC name is N-[(1S)-3-methyl-1-[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]pyridine-3-carboxamide.
| Compound Name | N-[(1S)-3-methyl-1-[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 42498918 |
| Molecular Formula | C22H28N6OS |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-[(1S)-3-methyl-1-[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]pyridine-3-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)c1cccnc1)c1nnc2n1CCN(Cc1ccsc1)CC2 |
| InChI | InChI=1S/C22H28N6OS/c1-16(2)12-19(24-22(29)18-4-3-7-23-13-18)21-26-25-20-5-8-27(9-10-28(20)21)14-17-6-11-30-15-17/h3-4,6-7,11,13,15-16,19H,5,8-10,12,14H2,1-2H3,(H,24,29)/t19-/m0/s1 |
| InChIKey | RSORIAPCDYRQLJ-IBGZPJMESA-N |
| XLogP | 3.31 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |