C22H28F7N5O5 — CID 118746013
2-[[7-[(4-fluorophenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118746013) has the molecular formula C22H28F7N5O5 and a molecular weight of 575.48 g/mol. Its IUPAC name is 2-[[7-[(4-fluorophenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[[7-[(4-fluorophenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118746013 |
| Molecular Formula | C22H28F7N5O5 |
| Molecular Weight | 575.48 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 2-[[7-[(4-fluorophenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methoxy]-N,N-dimethylethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CCOCc1nnc2n1CCN(Cc1ccc(F)cc1)CC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26FN5O.2C2HF3O2/c1-22(2)11-12-25-14-18-21-20-17-7-8-23(9-10-24(17)18)13-15-3-5-16(19)6-4-15;2*3-2(4,5)1(6)7/h3-6H,7-14H2,1-2H3;2*(H,6,7) |
| InChIKey | HKIKJYPORJUBBS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|