C16H22N2O5 — CID 155858200
formic acid;1-[(3R,5R)-3-pyridin-2-yloxy-1-oxa-9-azaspiro[4.5]decan-9-yl]ethanone (PubChem CID 155858200) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is formic acid;1-[(3R,5R)-3-pyridin-2-yloxy-1-oxa-9-azaspiro[4.5]decan-9-yl]ethanone.
| Compound Name | formic acid;1-[(3R,5R)-3-pyridin-2-yloxy-1-oxa-9-azaspiro[4.5]decan-9-yl]ethanone |
|---|---|
| PubChem CID | 155858200 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | formic acid;1-[(3R,5R)-3-pyridin-2-yloxy-1-oxa-9-azaspiro[4.5]decan-9-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@@]2(C[C@@H](Oc3ccccn3)CO2)C1.O=CO |
| InChI | InChI=1S/C15H20N2O3.CH2O2/c1-12(18)17-8-4-6-15(11-17)9-13(10-19-15)20-14-5-2-3-7-16-14;2-1-3/h2-3,5,7,13H,4,6,8-11H2,1H3;1H,(H,2,3)/t13-,15-;/m1./s1 |
| InChIKey | LEKGBUCJZWZNGT-SWYZXDRTSA-N |
| XLogP | 1.33 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|