C18H24N2O5 — CID 155872470
cyclopropyl-[(3R,5R)-3-pyridin-2-yloxy-1-oxa-9-azaspiro[4.5]decan-9-yl]methanone;formic acid (PubChem CID 155872470) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is cyclopropyl-[(3R,5R)-3-pyridin-2-yloxy-1-oxa-9-azaspiro[4.5]decan-9-yl]methanone;formic acid.
| Compound Name | cyclopropyl-[(3R,5R)-3-pyridin-2-yloxy-1-oxa-9-azaspiro[4.5]decan-9-yl]methanone;formic acid |
|---|---|
| PubChem CID | 155872470 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | cyclopropyl-[(3R,5R)-3-pyridin-2-yloxy-1-oxa-9-azaspiro[4.5]decan-9-yl]methanone;formic acid |
| SMILES | O=C(C1CC1)N1CCC[C@@]2(C[C@@H](Oc3ccccn3)CO2)C1.O=CO |
| InChI | InChI=1S/C17H22N2O3.CH2O2/c20-16(13-5-6-13)19-9-3-7-17(12-19)10-14(11-21-17)22-15-4-1-2-8-18-15;2-1-3/h1-2,4,8,13-14H,3,5-7,9-12H2;1H,(H,2,3)/t14-,17-;/m1./s1 |
| InChIKey | OEQGUBMGCCTMGT-SATBOSKTSA-N |
| XLogP | 1.72 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|