C21H28N2O8 — CID 155870650
oxalic acid;oxolan-3-yl-[(3S,5R)-3-(pyridin-2-ylmethoxy)-1-oxa-9-azaspiro[4.5]decan-9-yl]methanone (PubChem CID 155870650) has the molecular formula C21H28N2O8 and a molecular weight of 436.46 g/mol. Its IUPAC name is oxalic acid;oxolan-3-yl-[(3S,5R)-3-(pyridin-2-ylmethoxy)-1-oxa-9-azaspiro[4.5]decan-9-yl]methanone.
| Compound Name | oxalic acid;oxolan-3-yl-[(3S,5R)-3-(pyridin-2-ylmethoxy)-1-oxa-9-azaspiro[4.5]decan-9-yl]methanone |
|---|---|
| PubChem CID | 155870650 |
| Molecular Formula | C21H28N2O8 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | oxalic acid;oxolan-3-yl-[(3S,5R)-3-(pyridin-2-ylmethoxy)-1-oxa-9-azaspiro[4.5]decan-9-yl]methanone |
| SMILES | O=C(C1CCOC1)N1CCC[C@@]2(C[C@H](OCc3ccccn3)CO2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H26N2O4.C2H2O4/c22-18(15-5-9-23-11-15)21-8-3-6-19(14-21)10-17(13-25-19)24-12-16-4-1-2-7-20-16;3-1(4)2(5)6/h1-2,4,7,15,17H,3,5-6,8-14H2;(H,3,4)(H,5,6)/t15?,17-,19+;/m0./s1 |
| InChIKey | JEMJGMCKNJETQN-YGHVPACYSA-N |
| XLogP | 0.94 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|