About 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one
4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one (PubChem CID 15585938) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one.
Analyze 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one?
The IUPAC name of 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one (CID 15585938) is 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one.
What is the SMILES notation for 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one?
The canonical SMILES for 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one is CC1(C)OC2C3COC(=O)C(C3)C2O1.
What is the InChIKey of 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one?
The InChIKey is XTHPBGCIJMXYNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-10(2)13-7-5-3-6(8(7)14-10)9(11)12-4-5/h5-8H,3-4H2,1-2H3.
What are the key properties of 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one?
4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one has a molecular weight of 198.22 g/mol, XLogP of 0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-3,5,9-trioxatricyclo[5.3.1.02,6]undecan-8-one is sourced from PubChem (CID 15585938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).