C10H13IO4 — CID 59039325
(10R)-10-iodo-4,4-dimethyl-3,5,8-trioxatricyclo[5.3.1.02,6]undecan-9-one (PubChem CID 59039325) has the molecular formula C10H13IO4 and a molecular weight of 324.11 g/mol. Its IUPAC name is (10R)-10-iodo-4,4-dimethyl-3,5,8-trioxatricyclo[5.3.1.02,6]undecan-9-one.
| Compound Name | (10R)-10-iodo-4,4-dimethyl-3,5,8-trioxatricyclo[5.3.1.02,6]undecan-9-one |
|---|---|
| PubChem CID | 59039325 |
| Molecular Formula | C10H13IO4 |
| Molecular Weight | 324.11 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | (10R)-10-iodo-4,4-dimethyl-3,5,8-trioxatricyclo[5.3.1.02,6]undecan-9-one |
| SMILES | CC1(C)OC2C3CC(C2O1)[C@@H](I)C(=O)O3 |
| InChI | InChI=1S/C10H13IO4/c1-10(2)14-7-4-3-5(8(7)15-10)13-9(12)6(4)11/h4-8H,3H2,1-2H3/t4?,5?,6-,7?,8?/m1/s1 |
| InChIKey | YFEOXOFZITXYNY-OMLXPJATSA-N |
| XLogP | 1.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.11 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|