C20H25F3N4O3 — CID 155862722
1-(cyclopropylmethyl)-6-[(1-methylpyrazol-4-yl)methylamino]-5,6,7,8-tetrahydroquinolin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 155862722) has the molecular formula C20H25F3N4O3 and a molecular weight of 426.44 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-6-[(1-methylpyrazol-4-yl)methylamino]-5,6,7,8-tetrahydroquinolin-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(cyclopropylmethyl)-6-[(1-methylpyrazol-4-yl)methylamino]-5,6,7,8-tetrahydroquinolin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155862722 |
| Molecular Formula | C20H25F3N4O3 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 1-(cyclopropylmethyl)-6-[(1-methylpyrazol-4-yl)methylamino]-5,6,7,8-tetrahydroquinolin-2-one;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(CNC2CCc3c(ccc(=O)n3CC3CC3)C2)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H24N4O.C2HF3O2/c1-21-11-14(10-20-21)9-19-16-5-6-17-15(8-16)4-7-18(23)22(17)12-13-2-3-13;3-2(4,5)1(6)7/h4,7,10-11,13,16,19H,2-3,5-6,8-9,12H2,1H3;(H,6,7) |
| InChIKey | GAKDNGCAGKSHOA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |