C20H24F3N5O4 — CID 118744560
N-[1-[2-(dimethylamino)ethyl]-2-oxo-5,6,7,8-tetrahydroquinolin-6-yl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118744560) has the molecular formula C20H24F3N5O4 and a molecular weight of 455.44 g/mol. Its IUPAC name is N-[1-[2-(dimethylamino)ethyl]-2-oxo-5,6,7,8-tetrahydroquinolin-6-yl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[1-[2-(dimethylamino)ethyl]-2-oxo-5,6,7,8-tetrahydroquinolin-6-yl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744560 |
| Molecular Formula | C20H24F3N5O4 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-[1-[2-(dimethylamino)ethyl]-2-oxo-5,6,7,8-tetrahydroquinolin-6-yl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCn1c2c(ccc1=O)CC(NC(=O)c1cnccn1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N5O2.C2HF3O2/c1-22(2)9-10-23-16-5-4-14(11-13(16)3-6-17(23)24)21-18(25)15-12-19-7-8-20-15;3-2(4,5)1(6)7/h3,6-8,12,14H,4-5,9-11H2,1-2H3,(H,21,25);(H,6,7) |
| InChIKey | DGDOMTJYMPKDOT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |