C24H25F3N4O4 — CID 155866207
N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-4,6-dimethylpyridine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155866207) has the molecular formula C24H25F3N4O4 and a molecular weight of 490.48 g/mol. Its IUPAC name is N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-4,6-dimethylpyridine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-4,6-dimethylpyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155866207 |
| Molecular Formula | C24H25F3N4O4 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-4,6-dimethylpyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C)nc(C(=O)NCC2OCCc3cn(Cc4ccccc4)nc32)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H24N4O2.C2HF3O2/c1-15-10-16(2)24-19(11-15)22(27)23-12-20-21-18(8-9-28-20)14-26(25-21)13-17-6-4-3-5-7-17;3-2(4,5)1(6)7/h3-7,10-11,14,20H,8-9,12-13H2,1-2H3,(H,23,27);(H,6,7) |
| InChIKey | ORGJAXSPZPSYDE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |