C22H26F3N3O5 — CID 155875322
(2S,3S)-N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-2-methyloxolane-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155875322) has the molecular formula C22H26F3N3O5 and a molecular weight of 469.46 g/mol. Its IUPAC name is (2S,3S)-N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-2-methyloxolane-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3S)-N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-2-methyloxolane-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155875322 |
| Molecular Formula | C22H26F3N3O5 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | (2S,3S)-N-[(2-benzyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl)methyl]-2-methyloxolane-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | C[C@@H]1OCC[C@@H]1C(=O)NCC1OCCc2cn(Cc3ccccc3)nc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H25N3O3.C2HF3O2/c1-14-17(8-10-25-14)20(24)21-11-18-19-16(7-9-26-18)13-23(22-19)12-15-5-3-2-4-6-15;3-2(4,5)1(6)7/h2-6,13-14,17-18H,7-12H2,1H3,(H,21,24);(H,6,7)/t14-,17-,18?;/m0./s1 |
| InChIKey | PEYKXIJSWVRBNW-DLAMFZBISA-N |
| XLogP | 2.72 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |