C22H24ClF4N3O4 — CID 155867077
(5-chloro-2-fluorophenyl)-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1,8-diazaspiro[3.5]nonan-8-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 155867077) has the molecular formula C22H24ClF4N3O4 and a molecular weight of 505.90 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl)-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1,8-diazaspiro[3.5]nonan-8-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | (5-chloro-2-fluorophenyl)-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1,8-diazaspiro[3.5]nonan-8-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155867077 |
| Molecular Formula | C22H24ClF4N3O4 |
| Molecular Weight | 505.90 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | (5-chloro-2-fluorophenyl)-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1,8-diazaspiro[3.5]nonan-8-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1noc(C)c1CN1CCC12CCCN(C(=O)c1cc(Cl)ccc1F)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H23ClFN3O2.C2HF3O2/c1-13-17(14(2)27-23-13)11-25-9-7-20(25)6-3-8-24(12-20)19(26)16-10-15(21)4-5-18(16)22;3-2(4,5)1(6)7/h4-5,10H,3,6-9,11-12H2,1-2H3;(H,6,7) |
| InChIKey | QZQAHUJLIYLJNM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.90 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |