C25H28F6N4O7 — CID 155867347
(4S,5S)-2-(1,3-benzodioxol-5-ylmethyl)-7-methyl-4-(2-methylpyrazol-3-yl)-2,7-diazaspiro[4.5]decan-6-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155867347) has the molecular formula C25H28F6N4O7 and a molecular weight of 610.51 g/mol. Its IUPAC name is (4S,5S)-2-(1,3-benzodioxol-5-ylmethyl)-7-methyl-4-(2-methylpyrazol-3-yl)-2,7-diazaspiro[4.5]decan-6-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4S,5S)-2-(1,3-benzodioxol-5-ylmethyl)-7-methyl-4-(2-methylpyrazol-3-yl)-2,7-diazaspiro[4.5]decan-6-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155867347 |
| Molecular Formula | C25H28F6N4O7 |
| Molecular Weight | 610.51 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | (4S,5S)-2-(1,3-benzodioxol-5-ylmethyl)-7-methyl-4-(2-methylpyrazol-3-yl)-2,7-diazaspiro[4.5]decan-6-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1CCC[C@]2(CN(Cc3ccc4c(c3)OCO4)C[C@H]2c2ccnn2C)C1=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H26N4O3.2C2HF3O2/c1-23-9-3-7-21(20(23)26)13-25(12-16(21)17-6-8-22-24(17)2)11-15-4-5-18-19(10-15)28-14-27-18;2*3-2(4,5)1(6)7/h4-6,8,10,16H,3,7,9,11-14H2,1-2H3;2*(H,6,7)/t16-,21+;;/m0../s1 |
| InChIKey | TUSZIPLMYKVVBF-GRTIZPKUSA-N |
| XLogP | 3.25 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |