C21H28F5N3O3S — CID 155868351
9-[(3,3-difluorocyclobutyl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 155868351) has the molecular formula C21H28F5N3O3S and a molecular weight of 497.53 g/mol. Its IUPAC name is 9-[(3,3-difluorocyclobutyl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 9-[(3,3-difluorocyclobutyl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155868351 |
| Molecular Formula | C21H28F5N3O3S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 9-[(3,3-difluorocyclobutyl)methyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2C(=O)CCC23CCCN(CC2CC(F)(F)C2)CC3)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H27F2N3OS.C2HF3O2/c1-14-22-16(13-26-14)12-24-17(25)3-5-18(24)4-2-7-23(8-6-18)11-15-9-19(20,21)10-15;3-2(4,5)1(6)7/h13,15H,2-12H2,1H3;(H,6,7) |
| InChIKey | ZWCBJSXOCYOGAQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |