C21H25F6N5O7S — CID 155868749
N-[2-(dimethylamino)ethyl]-5-ethyl-6,6-dioxo-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155868749) has the molecular formula C21H25F6N5O7S and a molecular weight of 605.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-5-ethyl-6,6-dioxo-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[2-(dimethylamino)ethyl]-5-ethyl-6,6-dioxo-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155868749 |
| Molecular Formula | C21H25F6N5O7S |
| Molecular Weight | 605.51 g/mol |
| Exact Mass | 605.14 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-5-ethyl-6,6-dioxo-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCN1Cc2c(C(=O)NCCN(C)C)ncn2-c2ccccc2S1(=O)=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23N5O3S.2C2HF3O2/c1-4-21-11-14-16(17(23)18-9-10-20(2)3)19-12-22(14)13-7-5-6-8-15(13)26(21,24)25;2*3-2(4,5)1(6)7/h5-8,12H,4,9-11H2,1-3H3,(H,18,23);2*(H,6,7) |
| InChIKey | LWEDZOGEGSZDNI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |