C18H22F3N5O5S — CID 155835604
N-[2-(dimethylamino)ethyl]-5-methyl-6,6-dioxo-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155835604) has the molecular formula C18H22F3N5O5S and a molecular weight of 477.47 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-5-methyl-6,6-dioxo-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(dimethylamino)ethyl]-5-methyl-6,6-dioxo-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155835604 |
| Molecular Formula | C18H22F3N5O5S |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-5-methyl-6,6-dioxo-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCNC(=O)c1ncn2c1CN(C)S(=O)(=O)c1ccccc1-2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H21N5O3S.C2HF3O2/c1-19(2)9-8-17-16(22)15-13-10-20(3)25(23,24)14-7-5-4-6-12(14)21(13)11-18-15;3-2(4,5)1(6)7/h4-7,11H,8-10H2,1-3H3,(H,17,22);(H,6,7) |
| InChIKey | JNBMLRALDGGTKN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |