C17H22N4O4S — CID 97442856
N-(3-ethoxypropyl)-5-methyl-6,6-dioxo-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide (PubChem CID 97442856) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-5-methyl-6,6-dioxo-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-5-methyl-6,6-dioxo-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide |
|---|---|
| PubChem CID | 97442856 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-(3-ethoxypropyl)-5-methyl-6,6-dioxo-4H-imidazo[5,1-d][1,2,5]benzothiadiazepine-3-carboxamide |
| SMILES | CCOCCCNC(=O)c1ncn2c1CN(C)S(=O)(=O)c1ccccc1-2 |
| InChI | InChI=1S/C17H22N4O4S/c1-3-25-10-6-9-18-17(22)16-14-11-20(2)26(23,24)15-8-5-4-7-13(15)21(14)12-19-16/h4-5,7-8,12H,3,6,9-11H2,1-2H3,(H,18,22) |
| InChIKey | UJJQVZPSEVORMM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|