C18H21F3N6O3 — CID 155869522
cyclopent-3-en-1-yl-[3-(pyrazol-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 155869522) has the molecular formula C18H21F3N6O3 and a molecular weight of 426.40 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-[3-(pyrazol-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | cyclopent-3-en-1-yl-[3-(pyrazol-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155869522 |
| Molecular Formula | C18H21F3N6O3 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | cyclopent-3-en-1-yl-[3-(pyrazol-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C1CC=CC1)N1CCCn2c(nnc2Cn2cccn2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H20N6O.C2HF3O2/c23-16(13-5-1-2-6-13)20-8-4-10-22-14(11-20)18-19-15(22)12-21-9-3-7-17-21;3-2(4,5)1(6)7/h1-3,7,9,13H,4-6,8,10-12H2;(H,6,7) |
| InChIKey | CNBPAWOPWVYTKU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|