C18H24N6O — CID 155871604
(1-methylcyclohex-3-en-1-yl)-[3-(pyrazol-1-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]methanone (PubChem CID 155871604) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is (1-methylcyclohex-3-en-1-yl)-[3-(pyrazol-1-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]methanone.
| Compound Name | (1-methylcyclohex-3-en-1-yl)-[3-(pyrazol-1-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]methanone |
|---|---|
| PubChem CID | 155871604 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (1-methylcyclohex-3-en-1-yl)-[3-(pyrazol-1-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]methanone |
| SMILES | CC1(C(=O)N2CCc3nnc(Cn4cccn4)n3CC2)CC=CCC1 |
| InChI | InChI=1S/C18H24N6O/c1-18(7-3-2-4-8-18)17(25)22-11-6-15-20-21-16(24(15)13-12-22)14-23-10-5-9-19-23/h2-3,5,9-10H,4,6-8,11-14H2,1H3 |
| InChIKey | QRHUDVKCYRAODA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|