C17H24N6O — CID 72874275
1-[4-[4-methyl-5-(pyrazol-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]pent-4-en-1-one (PubChem CID 72874275) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-[4-[4-methyl-5-(pyrazol-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]pent-4-en-1-one.
| Compound Name | 1-[4-[4-methyl-5-(pyrazol-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 72874275 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-[4-[4-methyl-5-(pyrazol-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1CCC(c2nnc(Cn3cccn3)n2C)CC1 |
| InChI | InChI=1S/C17H24N6O/c1-3-4-6-16(24)22-11-7-14(8-12-22)17-20-19-15(21(17)2)13-23-10-5-9-18-23/h3,5,9-10,14H,1,4,6-8,11-13H2,2H3 |
| InChIKey | LCBIYZPNDIVPFP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|