C19H25F3N2O3S — CID 155869669
(E)-1-[2-(dimethylamino)-7-azaspiro[3.5]nonan-7-yl]-3-thiophen-2-ylprop-2-en-1-one;2,2,2-trifluoroacetic acid (PubChem CID 155869669) has the molecular formula C19H25F3N2O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is (E)-1-[2-(dimethylamino)-7-azaspiro[3.5]nonan-7-yl]-3-thiophen-2-ylprop-2-en-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | (E)-1-[2-(dimethylamino)-7-azaspiro[3.5]nonan-7-yl]-3-thiophen-2-ylprop-2-en-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155869669 |
| Molecular Formula | C19H25F3N2O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (E)-1-[2-(dimethylamino)-7-azaspiro[3.5]nonan-7-yl]-3-thiophen-2-ylprop-2-en-1-one;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C1CC2(CCN(C(=O)/C=C/c3cccs3)CC2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N2OS.C2HF3O2/c1-18(2)14-12-17(13-14)7-9-19(10-8-17)16(20)6-5-15-4-3-11-21-15;3-2(4,5)1(6)7/h3-6,11,14H,7-10,12-13H2,1-2H3;(H,6,7)/b6-5+; |
| InChIKey | UOJREYQDTFYGKU-IPZCTEOASA-N |
| XLogP | 3.73 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|