C20H26N4OS — CID 155872133
6-(cyclohexylmethyl)-N-pyridin-4-yl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2-carboxamide (PubChem CID 155872133) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is 6-(cyclohexylmethyl)-N-pyridin-4-yl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2-carboxamide.
| Compound Name | 6-(cyclohexylmethyl)-N-pyridin-4-yl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2-carboxamide |
|---|---|
| PubChem CID | 155872133 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 6-(cyclohexylmethyl)-N-pyridin-4-yl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1nc2c(s1)CCN(CC1CCCCC1)CC2 |
| InChI | InChI=1S/C20H26N4OS/c25-19(22-16-6-10-21-11-7-16)20-23-17-8-12-24(13-9-18(17)26-20)14-15-4-2-1-3-5-15/h6-7,10-11,15H,1-5,8-9,12-14H2,(H,21,22,25) |
| InChIKey | FEKGLFHXIUOGOO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |