C20H20ClN3O3 — CID 155872740
(3aR,6S,7aR)-4-(3-chlorobenzoyl)-N-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide (PubChem CID 155872740) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is (3aR,6S,7aR)-4-(3-chlorobenzoyl)-N-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide.
| Compound Name | (3aR,6S,7aR)-4-(3-chlorobenzoyl)-N-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 155872740 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (3aR,6S,7aR)-4-(3-chlorobenzoyl)-N-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
| SMILES | O=C(Nc1cccnc1)[C@H]1C[C@H]2OCC[C@H]2N(C(=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H20ClN3O3/c21-15-4-1-3-13(9-15)20(26)24-12-14(10-18-17(24)6-8-27-18)19(25)23-16-5-2-7-22-11-16/h1-5,7,9,11,14,17-18H,6,8,10,12H2,(H,23,25)/t14-,17+,18+/m0/s1 |
| InChIKey | NFUJWDAVMAWKTC-BMGDILEWSA-N |
| XLogP | 2.99 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |