C18H24N4O2S — CID 155872915
1-(cyclopent-3-ene-1-carbonyl)-N-cyclopropyl-4-(1,3-thiazol-2-ylamino)piperidine-4-carboxamide (PubChem CID 155872915) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 1-(cyclopent-3-ene-1-carbonyl)-N-cyclopropyl-4-(1,3-thiazol-2-ylamino)piperidine-4-carboxamide.
| Compound Name | 1-(cyclopent-3-ene-1-carbonyl)-N-cyclopropyl-4-(1,3-thiazol-2-ylamino)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155872915 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-(cyclopent-3-ene-1-carbonyl)-N-cyclopropyl-4-(1,3-thiazol-2-ylamino)piperidine-4-carboxamide |
| SMILES | O=C(C1CC=CC1)N1CCC(Nc2nccs2)(C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C18H24N4O2S/c23-15(13-3-1-2-4-13)22-10-7-18(8-11-22,16(24)20-14-5-6-14)21-17-19-9-12-25-17/h1-2,9,12-14H,3-8,10-11H2,(H,19,21)(H,20,24) |
| InChIKey | GVFWSQIBCHQCTA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|