C15H24N4O5S — CID 155873466
azetidin-1-yl-(1-ethylsulfonyl-4-imidazol-1-ylpiperidin-4-yl)methanone;formic acid (PubChem CID 155873466) has the molecular formula C15H24N4O5S and a molecular weight of 372.45 g/mol. Its IUPAC name is azetidin-1-yl-(1-ethylsulfonyl-4-imidazol-1-ylpiperidin-4-yl)methanone;formic acid.
| Compound Name | azetidin-1-yl-(1-ethylsulfonyl-4-imidazol-1-ylpiperidin-4-yl)methanone;formic acid |
|---|---|
| PubChem CID | 155873466 |
| Molecular Formula | C15H24N4O5S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | azetidin-1-yl-(1-ethylsulfonyl-4-imidazol-1-ylpiperidin-4-yl)methanone;formic acid |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)N2CCC2)(n2ccnc2)CC1.O=CO |
| InChI | InChI=1S/C14H22N4O3S.CH2O2/c1-2-22(20,21)18-9-4-14(5-10-18,17-11-6-15-12-17)13(19)16-7-3-8-16;2-1-3/h6,11-12H,2-5,7-10H2,1H3;1H,(H,2,3) |
| InChIKey | SNAZSBKOHDZGEA-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|