C18H25N5O4 — CID 155874442
1-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-(2-methoxyethyl)-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 155874442) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-(2-methoxyethyl)-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | 1-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-(2-methoxyethyl)-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 155874442 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-N-(2-methoxyethyl)-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1(n2cccn2)CCN(C(=O)c2c(C)noc2C)CC1 |
| InChI | InChI=1S/C18H25N5O4/c1-13-15(14(2)27-21-13)16(24)22-10-5-18(6-11-22,23-9-4-7-20-23)17(25)19-8-12-26-3/h4,7,9H,5-6,8,10-12H2,1-3H3,(H,19,25) |
| InChIKey | IOMOMNNCEAVMJJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|