C18H22F2N2O2 — CID 155874643
[(3R,3aS,6aS)-5-[(3,4-difluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 155874643) has the molecular formula C18H22F2N2O2 and a molecular weight of 336.38 g/mol. Its IUPAC name is [(3R,3aS,6aS)-5-[(3,4-difluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(3R,3aS,6aS)-5-[(3,4-difluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 155874643 |
| Molecular Formula | C18H22F2N2O2 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [(3R,3aS,6aS)-5-[(3,4-difluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C([C@H]1CO[C@@H]2CN(Cc3ccc(F)c(F)c3)C[C@H]12)N1CCCC1 |
| InChI | InChI=1S/C18H22F2N2O2/c19-15-4-3-12(7-16(15)20)8-21-9-13-14(11-24-17(13)10-21)18(23)22-5-1-2-6-22/h3-4,7,13-14,17H,1-2,5-6,8-11H2/t13-,14+,17-/m1/s1 |
| InChIKey | XIUICIPYVQYGDJ-JKIFEVAISA-N |
| XLogP | 2.03 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |