C22H32N2O4 — CID 155874867
cyclopentyl 4-[1-(5-methylfuran-2-carbonyl)piperidin-2-yl]piperidine-1-carboxylate (PubChem CID 155874867) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is cyclopentyl 4-[1-(5-methylfuran-2-carbonyl)piperidin-2-yl]piperidine-1-carboxylate.
| Compound Name | cyclopentyl 4-[1-(5-methylfuran-2-carbonyl)piperidin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155874867 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | cyclopentyl 4-[1-(5-methylfuran-2-carbonyl)piperidin-2-yl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(C(=O)N2CCCCC2C2CCN(C(=O)OC3CCCC3)CC2)o1 |
| InChI | InChI=1S/C22H32N2O4/c1-16-9-10-20(27-16)21(25)24-13-5-4-8-19(24)17-11-14-23(15-12-17)22(26)28-18-6-2-3-7-18/h9-10,17-19H,2-8,11-15H2,1H3 |
| InChIKey | FDJTYYNODAFVLH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |