C25H33N3O3S — CID 155874912
(3aS,6aS)-1-[[4-(diethylamino)phenyl]methyl]-4-[(4-methylsulfonylphenyl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one (PubChem CID 155874912) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is (3aS,6aS)-1-[[4-(diethylamino)phenyl]methyl]-4-[(4-methylsulfonylphenyl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | (3aS,6aS)-1-[[4-(diethylamino)phenyl]methyl]-4-[(4-methylsulfonylphenyl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 155874912 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | (3aS,6aS)-1-[[4-(diethylamino)phenyl]methyl]-4-[(4-methylsulfonylphenyl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
| SMILES | CCN(CC)c1ccc(CN2CC[C@H]3[C@@H]2CC(=O)N3Cc2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C25H33N3O3S/c1-4-26(5-2)21-10-6-19(7-11-21)17-27-15-14-23-24(27)16-25(29)28(23)18-20-8-12-22(13-9-20)32(3,30)31/h6-13,23-24H,4-5,14-18H2,1-3H3/t23-,24-/m0/s1 |
| InChIKey | WPFYEKSTABPUFJ-ZEQRLZLVSA-N |
| XLogP | 3.31 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|