C25H38N2O2 — CID 155874944
2-(oxan-4-yl)-N-[7-[(4-propan-2-ylphenyl)methyl]-7-azaspiro[3.5]nonan-2-yl]acetamide (PubChem CID 155874944) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is 2-(oxan-4-yl)-N-[7-[(4-propan-2-ylphenyl)methyl]-7-azaspiro[3.5]nonan-2-yl]acetamide.
| Compound Name | 2-(oxan-4-yl)-N-[7-[(4-propan-2-ylphenyl)methyl]-7-azaspiro[3.5]nonan-2-yl]acetamide |
|---|---|
| PubChem CID | 155874944 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | 2-(oxan-4-yl)-N-[7-[(4-propan-2-ylphenyl)methyl]-7-azaspiro[3.5]nonan-2-yl]acetamide |
| SMILES | CC(C)c1ccc(CN2CCC3(CC2)CC(NC(=O)CC2CCOCC2)C3)cc1 |
| InChI | InChI=1S/C25H38N2O2/c1-19(2)22-5-3-21(4-6-22)18-27-11-9-25(10-12-27)16-23(17-25)26-24(28)15-20-7-13-29-14-8-20/h3-6,19-20,23H,7-18H2,1-2H3,(H,26,28) |
| InChIKey | BWPAIHDSGNFVPN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |