C17H25N3OS — CID 155877266
1-[(3aR,8aS)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-2-methylprop-2-en-1-one (PubChem CID 155877266) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is 1-[(3aR,8aS)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-2-methylprop-2-en-1-one.
| Compound Name | 1-[(3aR,8aS)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 155877266 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 1-[(3aR,8aS)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)N1C[C@H]2CCN(Cc3csc(C)n3)CC[C@H]2C1 |
| InChI | InChI=1S/C17H25N3OS/c1-12(2)17(21)20-8-14-4-6-19(7-5-15(14)9-20)10-16-11-22-13(3)18-16/h11,14-15H,1,4-10H2,2-3H3/t14-,15+ |
| InChIKey | GYGQLXLDFFENIX-GASCZTMLSA-N |
| XLogP | 2.70 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|