C18H27N5S — CID 155877144
4-[[(3aS,8aR)-2-[(5-methyl-1H-pyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl]methyl]-2-methyl-1,3-thiazole (PubChem CID 155877144) has the molecular formula C18H27N5S and a molecular weight of 345.52 g/mol. Its IUPAC name is 4-[[(3aS,8aR)-2-[(5-methyl-1H-pyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl]methyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[[(3aS,8aR)-2-[(5-methyl-1H-pyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl]methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 155877144 |
| Molecular Formula | C18H27N5S |
| Molecular Weight | 345.52 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 4-[[(3aS,8aR)-2-[(5-methyl-1H-pyrazol-3-yl)methyl]-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-6-yl]methyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1cc(CN2C[C@H]3CCN(Cc4csc(C)n4)CC[C@H]3C2)n[nH]1 |
| InChI | InChI=1S/C18H27N5S/c1-13-7-17(21-20-13)10-23-8-15-3-5-22(6-4-16(15)9-23)11-18-12-24-14(2)19-18/h7,12,15-16H,3-6,8-11H2,1-2H3,(H,20,21)/t15-,16+ |
| InChIKey | MCZDWJBZYOLZED-IYBDPMFKSA-N |
| XLogP | 2.83 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |