C13H27N3 — CID 142930412
ethane;5-methyl-3-(pyrrolidin-1-ylmethyl)-1H-pyrazole (PubChem CID 142930412) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is ethane;5-methyl-3-(pyrrolidin-1-ylmethyl)-1H-pyrazole.
| Compound Name | ethane;5-methyl-3-(pyrrolidin-1-ylmethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 142930412 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | ethane;5-methyl-3-(pyrrolidin-1-ylmethyl)-1H-pyrazole |
| SMILES | CC.CC.Cc1cc(CN2CCCC2)n[nH]1 |
| InChI | InChI=1S/C9H15N3.2C2H6/c1-8-6-9(11-10-8)7-12-4-2-3-5-12;2*1-2/h6H,2-5,7H2,1H3,(H,10,11);2*1-2H3 |
| InChIKey | VPEFYAIBESDHIB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |