C18H25N3O2 — CID 155877544
(6-methyl-3-pyridinyl)-(4-prop-2-enyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl)methanone (PubChem CID 155877544) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (6-methyl-3-pyridinyl)-(4-prop-2-enyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl)methanone.
| Compound Name | (6-methyl-3-pyridinyl)-(4-prop-2-enyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl)methanone |
|---|---|
| PubChem CID | 155877544 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (6-methyl-3-pyridinyl)-(4-prop-2-enyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl)methanone |
| SMILES | C=CCN1CCOC2CCN(C(=O)c3ccc(C)nc3)CCC21 |
| InChI | InChI=1S/C18H25N3O2/c1-3-8-20-11-12-23-17-7-10-21(9-6-16(17)20)18(22)15-5-4-14(2)19-13-15/h3-5,13,16-17H,1,6-12H2,2H3 |
| InChIKey | XRXAONPSEXVCHW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|