C14H20N4O2S — CID 134078233
(4-prop-2-enyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl)-(thiadiazol-4-yl)methanone (PubChem CID 134078233) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is (4-prop-2-enyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl)-(thiadiazol-4-yl)methanone.
| Compound Name | (4-prop-2-enyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl)-(thiadiazol-4-yl)methanone |
|---|---|
| PubChem CID | 134078233 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (4-prop-2-enyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl)-(thiadiazol-4-yl)methanone |
| SMILES | C=CCN1CCOC2CCN(C(=O)c3csnn3)CCC21 |
| InChI | InChI=1S/C14H20N4O2S/c1-2-5-17-8-9-20-13-4-7-18(6-3-12(13)17)14(19)11-10-21-16-15-11/h2,10,12-13H,1,3-9H2 |
| InChIKey | LDDGUTZKKSDUTC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|