C16H20N2O3S — CID 155877866
(2R,3aS,7aR)-N-methyl-6-[(E)-3-thiophen-2-ylprop-2-enoyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide (PubChem CID 155877866) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is (2R,3aS,7aR)-N-methyl-6-[(E)-3-thiophen-2-ylprop-2-enoyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | (2R,3aS,7aR)-N-methyl-6-[(E)-3-thiophen-2-ylprop-2-enoyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155877866 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (2R,3aS,7aR)-N-methyl-6-[(E)-3-thiophen-2-ylprop-2-enoyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
| SMILES | CNC(=O)[C@H]1C[C@@H]2CCN(C(=O)/C=C/c3cccs3)C[C@@H]2O1 |
| InChI | InChI=1S/C16H20N2O3S/c1-17-16(20)13-9-11-6-7-18(10-14(11)21-13)15(19)5-4-12-3-2-8-22-12/h2-5,8,11,13-14H,6-7,9-10H2,1H3,(H,17,20)/b5-4+/t11-,13+,14-/m0/s1 |
| InChIKey | YNPRPJNUIHCCMP-WVUWEAKVSA-N |
| XLogP | 1.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|