C17H25ClN2O3S2 — CID 155878044
2-(4-chloro-2,5-dimethylphenyl)sulfonyl-N-(2-methoxyethyl)-5-thia-2-azaspiro[3.4]octan-7-amine (PubChem CID 155878044) has the molecular formula C17H25ClN2O3S2 and a molecular weight of 404.99 g/mol. Its IUPAC name is 2-(4-chloro-2,5-dimethylphenyl)sulfonyl-N-(2-methoxyethyl)-5-thia-2-azaspiro[3.4]octan-7-amine.
| Compound Name | 2-(4-chloro-2,5-dimethylphenyl)sulfonyl-N-(2-methoxyethyl)-5-thia-2-azaspiro[3.4]octan-7-amine |
|---|---|
| PubChem CID | 155878044 |
| Molecular Formula | C17H25ClN2O3S2 |
| Molecular Weight | 404.99 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-(4-chloro-2,5-dimethylphenyl)sulfonyl-N-(2-methoxyethyl)-5-thia-2-azaspiro[3.4]octan-7-amine |
| SMILES | COCCNC1CSC2(C1)CN(S(=O)(=O)c1cc(C)c(Cl)cc1C)C2 |
| InChI | InChI=1S/C17H25ClN2O3S2/c1-12-7-16(13(2)6-15(12)18)25(21,22)20-10-17(11-20)8-14(9-24-17)19-4-5-23-3/h6-7,14,19H,4-5,8-11H2,1-3H3 |
| InChIKey | XFCHFBDXRASZJX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.99 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|