C15H22N4O2 — CID 155879426
6-N-cyclobutyl-1-N,1-N-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide (PubChem CID 155879426) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 6-N-cyclobutyl-1-N,1-N-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide.
| Compound Name | 6-N-cyclobutyl-1-N,1-N-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide |
|---|---|
| PubChem CID | 155879426 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 6-N-cyclobutyl-1-N,1-N-dimethyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide |
| SMILES | CN(C)C(=O)c1ncn2c1CCC(C(=O)NC1CCC1)C2 |
| InChI | InChI=1S/C15H22N4O2/c1-18(2)15(21)13-12-7-6-10(8-19(12)9-16-13)14(20)17-11-4-3-5-11/h9-11H,3-8H2,1-2H3,(H,17,20) |
| InChIKey | RNGHHKQFWKSGDE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |