C18H28N4O4 — CID 155872404
1-N-butyl-6-N-(cyclopropylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide;formic acid (PubChem CID 155872404) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-N-butyl-6-N-(cyclopropylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide;formic acid.
| Compound Name | 1-N-butyl-6-N-(cyclopropylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide;formic acid |
|---|---|
| PubChem CID | 155872404 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 1-N-butyl-6-N-(cyclopropylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide;formic acid |
| SMILES | CCCCNC(=O)c1ncn2c1CCC(C(=O)NCC1CC1)C2.O=CO |
| InChI | InChI=1S/C17H26N4O2.CH2O2/c1-2-3-8-18-17(23)15-14-7-6-13(10-21(14)11-20-15)16(22)19-9-12-4-5-12;2-1-3/h11-13H,2-10H2,1H3,(H,18,23)(H,19,22);1H,(H,2,3) |
| InChIKey | XCQUYUFUFVARBX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|